C17H22Cl2N4O — CID 108825180
(Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-(diethylamino)propylamino]prop-2-enamide (PubChem CID 108825180) has the molecular formula C17H22Cl2N4O and a molecular weight of 369.30 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-(diethylamino)propylamino]prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-(diethylamino)propylamino]prop-2-enamide |
|---|---|
| PubChem CID | 108825180 |
| Molecular Formula | C17H22Cl2N4O |
| Molecular Weight | 369.30 g/mol |
| Exact Mass | 368.12 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dichlorophenyl)-3-[3-(diethylamino)propylamino]prop-2-enamide |
| SMILES | CCN(CC)CCCN/C=C(/C#N)C(=O)Nc1cccc(Cl)c1Cl |
| InChI | InChI=1S/C17H22Cl2N4O/c1-3-23(4-2)10-6-9-21-12-13(11-20)17(24)22-15-8-5-7-14(18)16(15)19/h5,7-8,12,21H,3-4,6,9-10H2,1-2H3,(H,22,24)/b13-12- |
| InChIKey | YXEYLUSWVQNLKB-SEYXRHQNSA-N |
| XLogP | 3.66 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.30 |
| LogP ≤ 5 | 3.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|