C18H23Cl2N3O — CID 108825179
(Z)-2-cyano-3-(dibutylamino)-N-(2,3-dichlorophenyl)prop-2-enamide (PubChem CID 108825179) has the molecular formula C18H23Cl2N3O and a molecular weight of 368.31 g/mol. Its IUPAC name is (Z)-2-cyano-3-(dibutylamino)-N-(2,3-dichlorophenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-(dibutylamino)-N-(2,3-dichlorophenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108825179 |
| Molecular Formula | C18H23Cl2N3O |
| Molecular Weight | 368.31 g/mol |
| Exact Mass | 367.12 |
| IUPAC Name | (Z)-2-cyano-3-(dibutylamino)-N-(2,3-dichlorophenyl)prop-2-enamide |
| SMILES | CCCCN(/C=C(/C#N)C(=O)Nc1cccc(Cl)c1Cl)CCCC |
| InChI | InChI=1S/C18H23Cl2N3O/c1-3-5-10-23(11-6-4-2)13-14(12-21)18(24)22-16-9-7-8-15(19)17(16)20/h7-9,13H,3-6,10-11H2,1-2H3,(H,22,24)/b14-13- |
| InChIKey | BMIMVYAFSYEUSX-YPKPFQOOSA-N |
| XLogP | 5.24 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.31 |
| LogP ≤ 5 | 5.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|