C19H28N4O — CID 108857894
(Z)-2-cyano-3-[3-(diethylamino)propylamino]-N-(2,4-dimethylphenyl)prop-2-enamide (PubChem CID 108857894) has the molecular formula C19H28N4O and a molecular weight of 328.46 g/mol. Its IUPAC name is (Z)-2-cyano-3-[3-(diethylamino)propylamino]-N-(2,4-dimethylphenyl)prop-2-enamide.
| Compound Name | (Z)-2-cyano-3-[3-(diethylamino)propylamino]-N-(2,4-dimethylphenyl)prop-2-enamide |
|---|---|
| PubChem CID | 108857894 |
| Molecular Formula | C19H28N4O |
| Molecular Weight | 328.46 g/mol |
| Exact Mass | 328.23 |
| IUPAC Name | (Z)-2-cyano-3-[3-(diethylamino)propylamino]-N-(2,4-dimethylphenyl)prop-2-enamide |
| SMILES | CCN(CC)CCCN/C=C(/C#N)C(=O)Nc1ccc(C)cc1C |
| InChI | InChI=1S/C19H28N4O/c1-5-23(6-2)11-7-10-21-14-17(13-20)19(24)22-18-9-8-15(3)12-16(18)4/h8-9,12,14,21H,5-7,10-11H2,1-4H3,(H,22,24)/b17-14- |
| InChIKey | DIOBVMVPXSPWPV-VKAVYKQESA-N |
| XLogP | 2.97 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 328.46 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|