C21H25N3O5 — CID 108831251
ethyl 1-[(Z)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108831251) has the molecular formula C21H25N3O5 and a molecular weight of 399.45 g/mol. Its IUPAC name is ethyl 1-[(Z)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108831251 |
| Molecular Formula | C21H25N3O5 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.18 |
| IUPAC Name | ethyl 1-[(Z)-2-cyano-3-(2,3-dihydro-1,4-benzodioxin-3-ylmethylamino)prop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C(C#N)=C\NCC2COc3ccccc3O2)CC1 |
| InChI | InChI=1S/C21H25N3O5/c1-2-27-21(26)15-7-9-24(10-8-15)20(25)16(11-22)12-23-13-17-14-28-18-5-3-4-6-19(18)29-17/h3-6,12,15,17,23H,2,7-10,13-14H2,1H3/b16-12- |
| InChIKey | NQZSSYYJMIPBJV-VBKFSLOCSA-N |
| XLogP | 1.63 |
| TPSA | 100.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|