C18H29N3O3 — CID 108832315
1-[(Z)-3-[bis(2-methylpropyl)amino]-2-cyanoprop-2-enoyl]piperidine-4-carboxylic acid (PubChem CID 108832315) has the molecular formula C18H29N3O3 and a molecular weight of 335.45 g/mol. Its IUPAC name is 1-[(Z)-3-[bis(2-methylpropyl)amino]-2-cyanoprop-2-enoyl]piperidine-4-carboxylic acid.
| Compound Name | 1-[(Z)-3-[bis(2-methylpropyl)amino]-2-cyanoprop-2-enoyl]piperidine-4-carboxylic acid |
|---|---|
| PubChem CID | 108832315 |
| Molecular Formula | C18H29N3O3 |
| Molecular Weight | 335.45 g/mol |
| Exact Mass | 335.22 |
| IUPAC Name | 1-[(Z)-3-[bis(2-methylpropyl)amino]-2-cyanoprop-2-enoyl]piperidine-4-carboxylic acid |
| SMILES | CC(C)CN(/C=C(/C#N)C(=O)N1CCC(C(=O)O)CC1)CC(C)C |
| InChI | InChI=1S/C18H29N3O3/c1-13(2)10-20(11-14(3)4)12-16(9-19)17(22)21-7-5-15(6-8-21)18(23)24/h12-15H,5-8,10-11H2,1-4H3,(H,23,24)/b16-12- |
| InChIKey | ZEAHXUBYVKSCEV-VBKFSLOCSA-N |
| XLogP | 2.33 |
| TPSA | 84.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.45 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|