C25H27N3O3 — CID 108831170
ethyl 1-[(Z)-3-(N-benzylanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate (PubChem CID 108831170) has the molecular formula C25H27N3O3 and a molecular weight of 417.51 g/mol. Its IUPAC name is ethyl 1-[(Z)-3-(N-benzylanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate.
| Compound Name | ethyl 1-[(Z)-3-(N-benzylanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate |
|---|---|
| PubChem CID | 108831170 |
| Molecular Formula | C25H27N3O3 |
| Molecular Weight | 417.51 g/mol |
| Exact Mass | 417.21 |
| IUPAC Name | ethyl 1-[(Z)-3-(N-benzylanilino)-2-cyanoprop-2-enoyl]piperidine-4-carboxylate |
| SMILES | CCOC(=O)C1CCN(C(=O)/C(C#N)=C\N(Cc2ccccc2)c2ccccc2)CC1 |
| InChI | InChI=1S/C25H27N3O3/c1-2-31-25(30)21-13-15-27(16-14-21)24(29)22(17-26)19-28(23-11-7-4-8-12-23)18-20-9-5-3-6-10-20/h3-12,19,21H,2,13-16,18H2,1H3/b22-19- |
| InChIKey | FAIBKKAHXOTYHV-QOCHGBHMSA-N |
| XLogP | 3.90 |
| TPSA | 73.64 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.51 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|