C22H20F3N3O — CID 108838317
(Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(2,3,4-trifluoroanilino)prop-2-enenitrile (PubChem CID 108838317) has the molecular formula C22H20F3N3O and a molecular weight of 399.42 g/mol. Its IUPAC name is (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(2,3,4-trifluoroanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(2,3,4-trifluoroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108838317 |
| Molecular Formula | C22H20F3N3O |
| Molecular Weight | 399.42 g/mol |
| Exact Mass | 399.16 |
| IUPAC Name | (Z)-2-(4-benzylpiperidine-1-carbonyl)-3-(2,3,4-trifluoroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1ccc(F)c(F)c1F)C(=O)N1CCC(Cc2ccccc2)CC1 |
| InChI | InChI=1S/C22H20F3N3O/c23-18-6-7-19(21(25)20(18)24)27-14-17(13-26)22(29)28-10-8-16(9-11-28)12-15-4-2-1-3-5-15/h1-7,14,16,27H,8-12H2/b17-14- |
| InChIKey | MZYFHSISLXDDFK-VKAVYKQESA-N |
| XLogP | 4.40 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|