C14H13F3N4O — CID 108820088
(Z)-2-(piperazine-1-carbonyl)-3-(2,3,4-trifluoroanilino)prop-2-enenitrile (PubChem CID 108820088) has the molecular formula C14H13F3N4O and a molecular weight of 310.28 g/mol. Its IUPAC name is (Z)-2-(piperazine-1-carbonyl)-3-(2,3,4-trifluoroanilino)prop-2-enenitrile.
| Compound Name | (Z)-2-(piperazine-1-carbonyl)-3-(2,3,4-trifluoroanilino)prop-2-enenitrile |
|---|---|
| PubChem CID | 108820088 |
| Molecular Formula | C14H13F3N4O |
| Molecular Weight | 310.28 g/mol |
| Exact Mass | 310.10 |
| IUPAC Name | (Z)-2-(piperazine-1-carbonyl)-3-(2,3,4-trifluoroanilino)prop-2-enenitrile |
| SMILES | N#C/C(=C/Nc1ccc(F)c(F)c1F)C(=O)N1CCNCC1 |
| InChI | InChI=1S/C14H13F3N4O/c15-10-1-2-11(13(17)12(10)16)20-8-9(7-18)14(22)21-5-3-19-4-6-21/h1-2,8,19-20H,3-6H2/b9-8- |
| InChIKey | CUSHOUMCDOZDMK-HJWRWDBZSA-N |
| XLogP | 1.36 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 310.28 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|