C13H17N5OS — CID 108820016
(Z)-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-(piperazine-1-carbonyl)prop-2-enenitrile (PubChem CID 108820016) has the molecular formula C13H17N5OS and a molecular weight of 291.38 g/mol. Its IUPAC name is (Z)-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-(piperazine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-(piperazine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108820016 |
| Molecular Formula | C13H17N5OS |
| Molecular Weight | 291.38 g/mol |
| Exact Mass | 291.12 |
| IUPAC Name | (Z)-3-[(4,5-dimethyl-1,3-thiazol-2-yl)amino]-2-(piperazine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1nc(N/C=C(/C#N)C(=O)N2CCNCC2)sc1C |
| InChI | InChI=1S/C13H17N5OS/c1-9-10(2)20-13(17-9)16-8-11(7-14)12(19)18-5-3-15-4-6-18/h8,15H,3-6H2,1-2H3,(H,16,17)/b11-8- |
| InChIKey | AAAAKZHTMVNVTL-FLIBITNWSA-N |
| XLogP | 1.01 |
| TPSA | 81.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.38 |
| LogP ≤ 5 | 1.01 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|