C17H20BrN3O — CID 108831994
(Z)-3-(4-bromo-3-methylanilino)-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile (PubChem CID 108831994) has the molecular formula C17H20BrN3O and a molecular weight of 362.27 g/mol. Its IUPAC name is (Z)-3-(4-bromo-3-methylanilino)-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile.
| Compound Name | (Z)-3-(4-bromo-3-methylanilino)-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 108831994 |
| Molecular Formula | C17H20BrN3O |
| Molecular Weight | 362.27 g/mol |
| Exact Mass | 361.08 |
| IUPAC Name | (Z)-3-(4-bromo-3-methylanilino)-2-(4-methylpiperidine-1-carbonyl)prop-2-enenitrile |
| SMILES | Cc1cc(N/C=C(/C#N)C(=O)N2CCC(C)CC2)ccc1Br |
| InChI | InChI=1S/C17H20BrN3O/c1-12-5-7-21(8-6-12)17(22)14(10-19)11-20-15-3-4-16(18)13(2)9-15/h3-4,9,11-12,20H,5-8H2,1-2H3/b14-11- |
| InChIKey | RFBLJSDCGJAUFM-KAMYIIQDSA-N |
| XLogP | 3.84 |
| TPSA | 56.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.27 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|