C17H19FN4O — CID 108854994
(Z)-3-(cyclopropylamino)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile (PubChem CID 108854994) has the molecular formula C17H19FN4O and a molecular weight of 314.36 g/mol. Its IUPAC name is (Z)-3-(cyclopropylamino)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile.
| Compound Name | (Z)-3-(cyclopropylamino)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 108854994 |
| Molecular Formula | C17H19FN4O |
| Molecular Weight | 314.36 g/mol |
| Exact Mass | 314.15 |
| IUPAC Name | (Z)-3-(cyclopropylamino)-2-[4-(4-fluorophenyl)piperazine-1-carbonyl]prop-2-enenitrile |
| SMILES | N#C/C(=C/NC1CC1)C(=O)N1CCN(c2ccc(F)cc2)CC1 |
| InChI | InChI=1S/C17H19FN4O/c18-14-1-5-16(6-2-14)21-7-9-22(10-8-21)17(23)13(11-19)12-20-15-3-4-15/h1-2,5-6,12,15,20H,3-4,7-10H2/b13-12- |
| InChIKey | FNZWYPIIRWTWBR-SEYXRHQNSA-N |
| XLogP | 1.63 |
| TPSA | 59.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 314.36 |
| LogP ≤ 5 | 1.63 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|