C21H22ClN5O — CID 108860495
(Z)-N-(3-chlorophenyl)-2-cyano-3-[4-(4-methylpiperazin-1-yl)anilino]prop-2-enamide (PubChem CID 108860495) has the molecular formula C21H22ClN5O and a molecular weight of 395.89 g/mol. Its IUPAC name is (Z)-N-(3-chlorophenyl)-2-cyano-3-[4-(4-methylpiperazin-1-yl)anilino]prop-2-enamide.
| Compound Name | (Z)-N-(3-chlorophenyl)-2-cyano-3-[4-(4-methylpiperazin-1-yl)anilino]prop-2-enamide |
|---|---|
| PubChem CID | 108860495 |
| Molecular Formula | C21H22ClN5O |
| Molecular Weight | 395.89 g/mol |
| Exact Mass | 395.15 |
| IUPAC Name | (Z)-N-(3-chlorophenyl)-2-cyano-3-[4-(4-methylpiperazin-1-yl)anilino]prop-2-enamide |
| SMILES | CN1CCN(c2ccc(N/C=C(/C#N)C(=O)Nc3cccc(Cl)c3)cc2)CC1 |
| InChI | InChI=1S/C21H22ClN5O/c1-26-9-11-27(12-10-26)20-7-5-18(6-8-20)24-15-16(14-23)21(28)25-19-4-2-3-17(22)13-19/h2-8,13,15,24H,9-12H2,1H3,(H,25,28)/b16-15- |
| InChIKey | FCMMGZCBACZGMR-NXVVXOECSA-N |
| XLogP | 3.55 |
| TPSA | 71.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.89 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|