C22H23ClN4O — CID 108822227
(Z)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enamide (PubChem CID 108822227) has the molecular formula C22H23ClN4O and a molecular weight of 394.91 g/mol. Its IUPAC name is (Z)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enamide.
| Compound Name | (Z)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108822227 |
| Molecular Formula | C22H23ClN4O |
| Molecular Weight | 394.91 g/mol |
| Exact Mass | 394.16 |
| IUPAC Name | (Z)-N-(3-chloro-4-methylphenyl)-2-cyano-3-(4-piperidin-1-ylanilino)prop-2-enamide |
| SMILES | Cc1ccc(NC(=O)/C(C#N)=C\Nc2ccc(N3CCCCC3)cc2)cc1Cl |
| InChI | InChI=1S/C22H23ClN4O/c1-16-5-6-19(13-21(16)23)26-22(28)17(14-24)15-25-18-7-9-20(10-8-18)27-11-3-2-4-12-27/h5-10,13,15,25H,2-4,11-12H2,1H3,(H,26,28)/b17-15- |
| InChIKey | ODFBRFUESJVKLG-ICFOKQHNSA-N |
| XLogP | 5.10 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 394.91 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|