C23H26N4O — CID 108857550
(Z)-2-cyano-N-(2,3-dimethylphenyl)-3-(4-piperidin-1-ylanilino)prop-2-enamide (PubChem CID 108857550) has the molecular formula C23H26N4O and a molecular weight of 374.49 g/mol. Its IUPAC name is (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-(4-piperidin-1-ylanilino)prop-2-enamide.
| Compound Name | (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-(4-piperidin-1-ylanilino)prop-2-enamide |
|---|---|
| PubChem CID | 108857550 |
| Molecular Formula | C23H26N4O |
| Molecular Weight | 374.49 g/mol |
| Exact Mass | 374.21 |
| IUPAC Name | (Z)-2-cyano-N-(2,3-dimethylphenyl)-3-(4-piperidin-1-ylanilino)prop-2-enamide |
| SMILES | Cc1cccc(NC(=O)/C(C#N)=C\Nc2ccc(N3CCCCC3)cc2)c1C |
| InChI | InChI=1S/C23H26N4O/c1-17-7-6-8-22(18(17)2)26-23(28)19(15-24)16-25-20-9-11-21(12-10-20)27-13-4-3-5-14-27/h6-12,16,25H,3-5,13-14H2,1-2H3,(H,26,28)/b19-16- |
| InChIKey | YFJKNKORPREDAA-MNDPQUGUSA-N |
| XLogP | 4.75 |
| TPSA | 68.16 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.49 |
| LogP ≤ 5 | 4.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'anil_di_alk_A(478)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|