C18H28N4O3 — CID 108835765
tert-butyl 4-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]piperazine-1-carboxylate (PubChem CID 108835765) has the molecular formula C18H28N4O3 and a molecular weight of 348.45 g/mol. Its IUPAC name is tert-butyl 4-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]piperazine-1-carboxylate.
| Compound Name | tert-butyl 4-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]piperazine-1-carboxylate |
|---|---|
| PubChem CID | 108835765 |
| Molecular Formula | C18H28N4O3 |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.22 |
| IUPAC Name | tert-butyl 4-[(Z)-2-cyano-3-(cyclopentylamino)-3-oxoprop-1-enyl]piperazine-1-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1CCN(/C=C(/C#N)C(=O)NC2CCCC2)CC1 |
| InChI | InChI=1S/C18H28N4O3/c1-18(2,3)25-17(24)22-10-8-21(9-11-22)13-14(12-19)16(23)20-15-6-4-5-7-15/h13,15H,4-11H2,1-3H3,(H,20,23)/b14-13- |
| InChIKey | DTWSNBZMGQRFTO-YPKPFQOOSA-N |
| XLogP | 2.01 |
| TPSA | 85.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|