C17H21N3O7S2 — CID 108819613
3-[[(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]prop-2-enoyl]amino]benzenesulfonic acid (PubChem CID 108819613) has the molecular formula C17H21N3O7S2 and a molecular weight of 443.50 g/mol. Its IUPAC name is 3-[[(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]prop-2-enoyl]amino]benzenesulfonic acid.
| Compound Name | 3-[[(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]prop-2-enoyl]amino]benzenesulfonic acid |
|---|---|
| PubChem CID | 108819613 |
| Molecular Formula | C17H21N3O7S2 |
| Molecular Weight | 443.50 g/mol |
| Exact Mass | 443.08 |
| IUPAC Name | 3-[[(Z)-2-cyano-3-[(1,1-dioxothiolan-3-yl)-(2-methoxyethyl)amino]prop-2-enoyl]amino]benzenesulfonic acid |
| SMILES | COCCN(/C=C(/C#N)C(=O)Nc1cccc(S(=O)(=O)O)c1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H21N3O7S2/c1-27-7-6-20(15-5-8-28(22,23)12-15)11-13(10-18)17(21)19-14-3-2-4-16(9-14)29(24,25)26/h2-4,9,11,15H,5-8,12H2,1H3,(H,19,21)(H,24,25,26)/b13-11- |
| InChIKey | LEBMTJPOBUVLMY-QBFSEMIESA-N |
| XLogP | 0.41 |
| TPSA | 153.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 443.50 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|