C17H32N4O5S — CID 108518470
N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)oxamide (PubChem CID 108518470) has the molecular formula C17H32N4O5S and a molecular weight of 404.53 g/mol. Its IUPAC name is N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)oxamide.
| Compound Name | N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)oxamide |
|---|---|
| PubChem CID | 108518470 |
| Molecular Formula | C17H32N4O5S |
| Molecular Weight | 404.53 g/mol |
| Exact Mass | 404.21 |
| IUPAC Name | N'-[2-(dimethylamino)ethyl]-N'-(1,1-dioxothiolan-3-yl)-N-(3-morpholin-4-ylpropyl)oxamide |
| SMILES | CN(C)CCN(C(=O)C(=O)NCCCN1CCOCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C17H32N4O5S/c1-19(2)7-8-21(15-4-13-27(24,25)14-15)17(23)16(22)18-5-3-6-20-9-11-26-12-10-20/h15H,3-14H2,1-2H3,(H,18,22) |
| InChIKey | RXDDTNGIOBPJGE-UHFFFAOYSA-N |
| XLogP | -1.60 |
| TPSA | 99.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.53 |
| LogP ≤ 5 | -1.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|