C15H29N3O4S — CID 109016730
N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(2-morpholin-4-ylethylamino)propanamide (PubChem CID 109016730) has the molecular formula C15H29N3O4S and a molecular weight of 347.48 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(2-morpholin-4-ylethylamino)propanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(2-morpholin-4-ylethylamino)propanamide |
|---|---|
| PubChem CID | 109016730 |
| Molecular Formula | C15H29N3O4S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.19 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-3-(2-morpholin-4-ylethylamino)propanamide |
| SMILES | CCN(C(=O)CCNCCN1CCOCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C15H29N3O4S/c1-2-18(14-4-12-23(20,21)13-14)15(19)3-5-16-6-7-17-8-10-22-11-9-17/h14,16H,2-13H2,1H3 |
| InChIKey | JPQIEBOICFWTSV-UHFFFAOYSA-N |
| XLogP | -0.67 |
| TPSA | 78.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | -0.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|