C18H32N2O4S — CID 108965235
N-cycloheptyl-N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-2,2-dimethylpropanediamide (PubChem CID 108965235) has the molecular formula C18H32N2O4S and a molecular weight of 372.53 g/mol. Its IUPAC name is N-cycloheptyl-N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-2,2-dimethylpropanediamide.
| Compound Name | N-cycloheptyl-N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-2,2-dimethylpropanediamide |
|---|---|
| PubChem CID | 108965235 |
| Molecular Formula | C18H32N2O4S |
| Molecular Weight | 372.53 g/mol |
| Exact Mass | 372.21 |
| IUPAC Name | N-cycloheptyl-N'-(1,1-dioxothiolan-3-yl)-N'-ethyl-2,2-dimethylpropanediamide |
| SMILES | CCN(C(=O)C(C)(C)C(=O)NC1CCCCCC1)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C18H32N2O4S/c1-4-20(15-11-12-25(23,24)13-15)17(22)18(2,3)16(21)19-14-9-7-5-6-8-10-14/h14-15H,4-13H2,1-3H3,(H,19,21) |
| InChIKey | XFSARCJIZWGNBY-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 83.55 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.53 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|