C9H13F4NO3S — CID 103732386
N-(1,1-dioxothiolan-3-yl)-N-ethyl-2,2,3,3-tetrafluoropropanamide (PubChem CID 103732386) has the molecular formula C9H13F4NO3S and a molecular weight of 291.27 g/mol. Its IUPAC name is N-(1,1-dioxothiolan-3-yl)-N-ethyl-2,2,3,3-tetrafluoropropanamide.
| Compound Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2,2,3,3-tetrafluoropropanamide |
|---|---|
| PubChem CID | 103732386 |
| Molecular Formula | C9H13F4NO3S |
| Molecular Weight | 291.27 g/mol |
| Exact Mass | 291.06 |
| IUPAC Name | N-(1,1-dioxothiolan-3-yl)-N-ethyl-2,2,3,3-tetrafluoropropanamide |
| SMILES | CCN(C(=O)C(F)(F)C(F)F)C1CCS(=O)(=O)C1 |
| InChI | InChI=1S/C9H13F4NO3S/c1-2-14(6-3-4-18(16,17)5-6)8(15)9(12,13)7(10)11/h6-7H,2-5H2,1H3 |
| InChIKey | BSIJCXGWIGREJC-UHFFFAOYSA-N |
| XLogP | 0.92 |
| TPSA | 54.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.27 |
| LogP ≤ 5 | 0.92 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Perfluorinated_chain', 'substructure': 'N/A'} |
|---|