C19H27NO3 — CID 110407933
2-cyclopentyl-2-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide (PubChem CID 110407933) has the molecular formula C19H27NO3 and a molecular weight of 317.43 g/mol. Its IUPAC name is 2-cyclopentyl-2-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide.
| Compound Name | 2-cyclopentyl-2-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide |
|---|---|
| PubChem CID | 110407933 |
| Molecular Formula | C19H27NO3 |
| Molecular Weight | 317.43 g/mol |
| Exact Mass | 317.20 |
| IUPAC Name | 2-cyclopentyl-2-(4-methoxyphenyl)-N-(oxolan-2-ylmethyl)acetamide |
| SMILES | COc1ccc(C(C(=O)NCC2CCCO2)C2CCCC2)cc1 |
| InChI | InChI=1S/C19H27NO3/c1-22-16-10-8-15(9-11-16)18(14-5-2-3-6-14)19(21)20-13-17-7-4-12-23-17/h8-11,14,17-18H,2-7,12-13H2,1H3,(H,20,21) |
| InChIKey | UMBHNHKKFISOOV-UHFFFAOYSA-N |
| XLogP | 3.26 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.43 |
| LogP ≤ 5 | 3.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |