C20H19ClN2OS — CID 42704217
3-(4-chlorophenyl)-1-(2-phenylethyl)-1-(thiophen-3-ylmethyl)urea (PubChem CID 42704217) has the molecular formula C20H19ClN2OS and a molecular weight of 370.91 g/mol. Its IUPAC name is 3-(4-chlorophenyl)-1-(2-phenylethyl)-1-(thiophen-3-ylmethyl)urea.
| Compound Name | 3-(4-chlorophenyl)-1-(2-phenylethyl)-1-(thiophen-3-ylmethyl)urea |
|---|---|
| PubChem CID | 42704217 |
| Molecular Formula | C20H19ClN2OS |
| Molecular Weight | 370.91 g/mol |
| Exact Mass | 370.09 |
| IUPAC Name | 3-(4-chlorophenyl)-1-(2-phenylethyl)-1-(thiophen-3-ylmethyl)urea |
| SMILES | O=C(Nc1ccc(Cl)cc1)N(CCc1ccccc1)Cc1ccsc1 |
| InChI | InChI=1S/C20H19ClN2OS/c21-18-6-8-19(9-7-18)22-20(24)23(14-17-11-13-25-15-17)12-10-16-4-2-1-3-5-16/h1-9,11,13,15H,10,12,14H2,(H,22,24) |
| InChIKey | RVPYZSRPDNQTJH-UHFFFAOYSA-N |
| XLogP | 5.68 |
| TPSA | 32.34 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.91 |
| LogP ≤ 5 | 5.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |