C16H21ClN4O — CID 118782620
3-(2-chloro-4,6-dimethylphenyl)-1-ethyl-1-(2-pyrazol-1-ylethyl)urea (PubChem CID 118782620) has the molecular formula C16H21ClN4O and a molecular weight of 320.82 g/mol. Its IUPAC name is 3-(2-chloro-4,6-dimethylphenyl)-1-ethyl-1-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 3-(2-chloro-4,6-dimethylphenyl)-1-ethyl-1-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 118782620 |
| Molecular Formula | C16H21ClN4O |
| Molecular Weight | 320.82 g/mol |
| Exact Mass | 320.14 |
| IUPAC Name | 3-(2-chloro-4,6-dimethylphenyl)-1-ethyl-1-(2-pyrazol-1-ylethyl)urea |
| SMILES | CCN(CCn1cccn1)C(=O)Nc1c(C)cc(C)cc1Cl |
| InChI | InChI=1S/C16H21ClN4O/c1-4-20(8-9-21-7-5-6-18-21)16(22)19-15-13(3)10-12(2)11-14(15)17/h5-7,10-11H,4,8-9H2,1-3H3,(H,19,22) |
| InChIKey | RCDPKYFVQAJOIT-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 50.16 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 320.82 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |