C11H17N7O — CID 72935395
1-ethyl-3-(1-methyltriazol-4-yl)-1-(2-pyrazol-1-ylethyl)urea (PubChem CID 72935395) has the molecular formula C11H17N7O and a molecular weight of 263.31 g/mol. Its IUPAC name is 1-ethyl-3-(1-methyltriazol-4-yl)-1-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 1-ethyl-3-(1-methyltriazol-4-yl)-1-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 72935395 |
| Molecular Formula | C11H17N7O |
| Molecular Weight | 263.31 g/mol |
| Exact Mass | 263.15 |
| IUPAC Name | 1-ethyl-3-(1-methyltriazol-4-yl)-1-(2-pyrazol-1-ylethyl)urea |
| SMILES | CCN(CCn1cccn1)C(=O)Nc1cn(C)nn1 |
| InChI | InChI=1S/C11H17N7O/c1-3-17(7-8-18-6-4-5-12-18)11(19)13-10-9-16(2)15-14-10/h4-6,9H,3,7-8H2,1-2H3,(H,13,19) |
| InChIKey | KAMLYVJXWHQKCA-UHFFFAOYSA-N |
| XLogP | 0.57 |
| TPSA | 80.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 263.31 |
| LogP ≤ 5 | 0.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |