C15H27N5O — CID 131947082
1-ethyl-3-(1-propylpyrrolidin-3-yl)-1-(2-pyrazol-1-ylethyl)urea (PubChem CID 131947082) has the molecular formula C15H27N5O and a molecular weight of 293.41 g/mol. Its IUPAC name is 1-ethyl-3-(1-propylpyrrolidin-3-yl)-1-(2-pyrazol-1-ylethyl)urea.
| Compound Name | 1-ethyl-3-(1-propylpyrrolidin-3-yl)-1-(2-pyrazol-1-ylethyl)urea |
|---|---|
| PubChem CID | 131947082 |
| Molecular Formula | C15H27N5O |
| Molecular Weight | 293.41 g/mol |
| Exact Mass | 293.22 |
| IUPAC Name | 1-ethyl-3-(1-propylpyrrolidin-3-yl)-1-(2-pyrazol-1-ylethyl)urea |
| SMILES | CCCN1CCC(NC(=O)N(CC)CCn2cccn2)C1 |
| InChI | InChI=1S/C15H27N5O/c1-3-8-18-10-6-14(13-18)17-15(21)19(4-2)11-12-20-9-5-7-16-20/h5,7,9,14H,3-4,6,8,10-13H2,1-2H3,(H,17,21) |
| InChIKey | RULJBCOFEHEAOH-UHFFFAOYSA-N |
| XLogP | 1.40 |
| TPSA | 53.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.41 |
| LogP ≤ 5 | 1.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |