C15H20FN5O3 — CID 74250651
1-[2-(2-fluorophenoxy)ethyl]-1-(2-methoxyethyl)-3-(1-methyltriazol-4-yl)urea (PubChem CID 74250651) has the molecular formula C15H20FN5O3 and a molecular weight of 337.36 g/mol. Its IUPAC name is 1-[2-(2-fluorophenoxy)ethyl]-1-(2-methoxyethyl)-3-(1-methyltriazol-4-yl)urea.
| Compound Name | 1-[2-(2-fluorophenoxy)ethyl]-1-(2-methoxyethyl)-3-(1-methyltriazol-4-yl)urea |
|---|---|
| PubChem CID | 74250651 |
| Molecular Formula | C15H20FN5O3 |
| Molecular Weight | 337.36 g/mol |
| Exact Mass | 337.16 |
| IUPAC Name | 1-[2-(2-fluorophenoxy)ethyl]-1-(2-methoxyethyl)-3-(1-methyltriazol-4-yl)urea |
| SMILES | COCCN(CCOc1ccccc1F)C(=O)Nc1cn(C)nn1 |
| InChI | InChI=1S/C15H20FN5O3/c1-20-11-14(18-19-20)17-15(22)21(7-9-23-2)8-10-24-13-6-4-3-5-12(13)16/h3-6,11H,7-10H2,1-2H3,(H,17,22) |
| InChIKey | GNVUPPRMDKGGJG-UHFFFAOYSA-N |
| XLogP | 1.51 |
| TPSA | 81.51 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 337.36 |
| LogP ≤ 5 | 1.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |