C13H19FN4O3 — CID 76993854
1-(3-amino-3-hydroxyiminopropyl)-3-(2-fluorophenyl)-1-(2-methoxyethyl)urea (PubChem CID 76993854) has the molecular formula C13H19FN4O3 and a molecular weight of 298.32 g/mol. Its IUPAC name is 1-(3-amino-3-hydroxyiminopropyl)-3-(2-fluorophenyl)-1-(2-methoxyethyl)urea.
| Compound Name | 1-(3-amino-3-hydroxyiminopropyl)-3-(2-fluorophenyl)-1-(2-methoxyethyl)urea |
|---|---|
| PubChem CID | 76993854 |
| Molecular Formula | C13H19FN4O3 |
| Molecular Weight | 298.32 g/mol |
| Exact Mass | 298.14 |
| IUPAC Name | 1-(3-amino-3-hydroxyiminopropyl)-3-(2-fluorophenyl)-1-(2-methoxyethyl)urea |
| SMILES | COCCN(CCC(N)=NO)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C13H19FN4O3/c1-21-9-8-18(7-6-12(15)17-20)13(19)16-11-5-3-2-4-10(11)14/h2-5,20H,6-9H2,1H3,(H2,15,17)(H,16,19) |
| InChIKey | MYRUJIINLUHVLH-UHFFFAOYSA-N |
| XLogP | 1.44 |
| TPSA | 100.18 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.32 |
| LogP ≤ 5 | 1.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|