C10H13FN4O2 — CID 76929064
1-(2-amino-2-hydroxyiminoethyl)-3-(2-fluorophenyl)-1-methylurea (PubChem CID 76929064) has the molecular formula C10H13FN4O2 and a molecular weight of 240.24 g/mol. Its IUPAC name is 1-(2-amino-2-hydroxyiminoethyl)-3-(2-fluorophenyl)-1-methylurea.
| Compound Name | 1-(2-amino-2-hydroxyiminoethyl)-3-(2-fluorophenyl)-1-methylurea |
|---|---|
| PubChem CID | 76929064 |
| Molecular Formula | C10H13FN4O2 |
| Molecular Weight | 240.24 g/mol |
| Exact Mass | 240.10 |
| IUPAC Name | 1-(2-amino-2-hydroxyiminoethyl)-3-(2-fluorophenyl)-1-methylurea |
| SMILES | CN(CC(N)=NO)C(=O)Nc1ccccc1F |
| InChI | InChI=1S/C10H13FN4O2/c1-15(6-9(12)14-17)10(16)13-8-5-3-2-4-7(8)11/h2-5,17H,6H2,1H3,(H2,12,14)(H,13,16) |
| InChIKey | QHNKHLUNWTZJMJ-UHFFFAOYSA-N |
| XLogP | 1.04 |
| TPSA | 90.95 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 240.24 |
| LogP ≤ 5 | 1.04 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'oxime_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|