C13H17N3O2 — CID 108983935
N'-methyl-N-prop-2-enyl-N'-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108983935) has the molecular formula C13H17N3O2 and a molecular weight of 247.30 g/mol. Its IUPAC name is N'-methyl-N-prop-2-enyl-N'-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N'-methyl-N-prop-2-enyl-N'-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108983935 |
| Molecular Formula | C13H17N3O2 |
| Molecular Weight | 247.30 g/mol |
| Exact Mass | 247.13 |
| IUPAC Name | N'-methyl-N-prop-2-enyl-N'-(2-pyridin-4-ylethyl)oxamide |
| SMILES | C=CCNC(=O)C(=O)N(C)CCc1ccncc1 |
| InChI | InChI=1S/C13H17N3O2/c1-3-7-15-12(17)13(18)16(2)10-6-11-4-8-14-9-5-11/h3-5,8-9H,1,6-7,10H2,2H3,(H,15,17) |
| InChIKey | TUJGOYZOIHLRDR-UHFFFAOYSA-N |
| XLogP | 0.38 |
| TPSA | 62.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.30 |
| LogP ≤ 5 | 0.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|