C18H21N3O2 — CID 108984872
N'-benzyl-N,N'-dimethyl-N-(2-pyridin-4-ylethyl)oxamide (PubChem CID 108984872) has the molecular formula C18H21N3O2 and a molecular weight of 311.39 g/mol. Its IUPAC name is N'-benzyl-N,N'-dimethyl-N-(2-pyridin-4-ylethyl)oxamide.
| Compound Name | N'-benzyl-N,N'-dimethyl-N-(2-pyridin-4-ylethyl)oxamide |
|---|---|
| PubChem CID | 108984872 |
| Molecular Formula | C18H21N3O2 |
| Molecular Weight | 311.39 g/mol |
| Exact Mass | 311.16 |
| IUPAC Name | N'-benzyl-N,N'-dimethyl-N-(2-pyridin-4-ylethyl)oxamide |
| SMILES | CN(CCc1ccncc1)C(=O)C(=O)N(C)Cc1ccccc1 |
| InChI | InChI=1S/C18H21N3O2/c1-20(13-10-15-8-11-19-12-9-15)17(22)18(23)21(2)14-16-6-4-3-5-7-16/h3-9,11-12H,10,13-14H2,1-2H3 |
| InChIKey | JPGMYIBUVVINOU-UHFFFAOYSA-N |
| XLogP | 1.74 |
| TPSA | 53.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.39 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|