C15H20N4O3 — CID 108984450
2-(4-formylpiperazin-1-yl)-N-methyl-2-oxo-N-(2-pyridin-4-ylethyl)acetamide (PubChem CID 108984450) has the molecular formula C15H20N4O3 and a molecular weight of 304.35 g/mol. Its IUPAC name is 2-(4-formylpiperazin-1-yl)-N-methyl-2-oxo-N-(2-pyridin-4-ylethyl)acetamide.
| Compound Name | 2-(4-formylpiperazin-1-yl)-N-methyl-2-oxo-N-(2-pyridin-4-ylethyl)acetamide |
|---|---|
| PubChem CID | 108984450 |
| Molecular Formula | C15H20N4O3 |
| Molecular Weight | 304.35 g/mol |
| Exact Mass | 304.15 |
| IUPAC Name | 2-(4-formylpiperazin-1-yl)-N-methyl-2-oxo-N-(2-pyridin-4-ylethyl)acetamide |
| SMILES | CN(CCc1ccncc1)C(=O)C(=O)N1CCN(C=O)CC1 |
| InChI | InChI=1S/C15H20N4O3/c1-17(7-4-13-2-5-16-6-3-13)14(21)15(22)19-10-8-18(12-20)9-11-19/h2-3,5-6,12H,4,7-11H2,1H3 |
| InChIKey | GEGAZNXQHGACEO-UHFFFAOYSA-N |
| XLogP | -0.62 |
| TPSA | 73.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.35 |
| LogP ≤ 5 | -0.62 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|