About N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide
N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide (PubChem CID 108521021) has the molecular formula C16H15BrN2O2
and a molecular weight of 347.21 g/mol. Its IUPAC name is N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide.
Molecular Properties
| Compound Name | N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide |
| PubChem CID | 108521021 |
| Molecular Formula | C16H15BrN2O2 |
| Molecular Weight | 347.21 g/mol |
| Exact Mass | 346.03 |
| IUPAC Name | N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide |
| SMILES | Cc1ccc(NC(=O)C(=O)N(C)c2ccccc2)c(Br)c1 |
| InChI | InChI=1S/C16H15BrN2O2/c1-11-8-9-14(13(17)10-11)18-15(20)16(21)19(2)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,18,20) |
| InChIKey | HQFSDONHRFLHDZ-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 49.41 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 347.21 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide?
The IUPAC name of N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide (CID 108521021) is N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide.
What is the SMILES notation for N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide?
The canonical SMILES for N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide is Cc1ccc(NC(=O)C(=O)N(C)c2ccccc2)c(Br)c1.
What is the InChIKey of N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide?
The InChIKey is HQFSDONHRFLHDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H15BrN2O2/c1-11-8-9-14(13(17)10-11)18-15(20)16(21)19(2)12-6-4-3-5-7-12/h3-10H,1-2H3,(H,18,20).
What are the key properties of N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide?
N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide has a molecular weight of 347.21 g/mol, XLogP of 3.36, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-bromo-4-methylphenyl)-N'-methyl-N'-phenyloxamide is sourced from PubChem (CID 108521021), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).