C20H18BrN3O — CID 109176370
2-(2-bromo-4-methylanilino)-N-methyl-N-phenylpyridine-4-carboxamide (PubChem CID 109176370) has the molecular formula C20H18BrN3O and a molecular weight of 396.29 g/mol. Its IUPAC name is 2-(2-bromo-4-methylanilino)-N-methyl-N-phenylpyridine-4-carboxamide.
| Compound Name | 2-(2-bromo-4-methylanilino)-N-methyl-N-phenylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 109176370 |
| Molecular Formula | C20H18BrN3O |
| Molecular Weight | 396.29 g/mol |
| Exact Mass | 395.06 |
| IUPAC Name | 2-(2-bromo-4-methylanilino)-N-methyl-N-phenylpyridine-4-carboxamide |
| SMILES | Cc1ccc(Nc2cc(C(=O)N(C)c3ccccc3)ccn2)c(Br)c1 |
| InChI | InChI=1S/C20H18BrN3O/c1-14-8-9-18(17(21)12-14)23-19-13-15(10-11-22-19)20(25)24(2)16-6-4-3-5-7-16/h3-13H,1-2H3,(H,22,23) |
| InChIKey | PZLRAMBLWVBBGE-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 45.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.29 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |