C15H14INO2 — CID 103750397
N-(4-hydroxyphenyl)-2-iodo-N,3-dimethylbenzamide (PubChem CID 103750397) has the molecular formula C15H14INO2 and a molecular weight of 367.19 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-2-iodo-N,3-dimethylbenzamide.
| Compound Name | N-(4-hydroxyphenyl)-2-iodo-N,3-dimethylbenzamide |
|---|---|
| PubChem CID | 103750397 |
| Molecular Formula | C15H14INO2 |
| Molecular Weight | 367.19 g/mol |
| Exact Mass | 367.01 |
| IUPAC Name | N-(4-hydroxyphenyl)-2-iodo-N,3-dimethylbenzamide |
| SMILES | Cc1cccc(C(=O)N(C)c2ccc(O)cc2)c1I |
| InChI | InChI=1S/C15H14INO2/c1-10-4-3-5-13(14(10)16)15(19)17(2)11-6-8-12(18)9-7-11/h3-9,18H,1-2H3 |
| InChIKey | JQFCUWXKNUYPDJ-UHFFFAOYSA-N |
| XLogP | 3.58 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.19 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|