C13H13NO2S — CID 28739196
N-(4-hydroxyphenyl)-N,3-dimethylthiophene-2-carboxamide (PubChem CID 28739196) has the molecular formula C13H13NO2S and a molecular weight of 247.32 g/mol. Its IUPAC name is N-(4-hydroxyphenyl)-N,3-dimethylthiophene-2-carboxamide.
| Compound Name | N-(4-hydroxyphenyl)-N,3-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 28739196 |
| Molecular Formula | C13H13NO2S |
| Molecular Weight | 247.32 g/mol |
| Exact Mass | 247.07 |
| IUPAC Name | N-(4-hydroxyphenyl)-N,3-dimethylthiophene-2-carboxamide |
| SMILES | Cc1ccsc1C(=O)N(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C13H13NO2S/c1-9-7-8-17-12(9)13(16)14(2)10-3-5-11(15)6-4-10/h3-8,15H,1-2H3 |
| InChIKey | CDDSYKDIZZQYDT-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 247.32 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |