C11H17NOS — CID 86978133
N-butyl-N,3-dimethylthiophene-2-carboxamide (PubChem CID 86978133) has the molecular formula C11H17NOS and a molecular weight of 211.33 g/mol. Its IUPAC name is N-butyl-N,3-dimethylthiophene-2-carboxamide.
| Compound Name | N-butyl-N,3-dimethylthiophene-2-carboxamide |
|---|---|
| PubChem CID | 86978133 |
| Molecular Formula | C11H17NOS |
| Molecular Weight | 211.33 g/mol |
| Exact Mass | 211.10 |
| IUPAC Name | N-butyl-N,3-dimethylthiophene-2-carboxamide |
| SMILES | CCCCN(C)C(=O)c1sccc1C |
| InChI | InChI=1S/C11H17NOS/c1-4-5-7-12(3)11(13)10-9(2)6-8-14-10/h6,8H,4-5,7H2,1-3H3 |
| InChIKey | ZHNZZMHTIQBRDX-UHFFFAOYSA-N |
| XLogP | 2.93 |
| TPSA | 20.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 211.33 |
| LogP ≤ 5 | 2.93 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |