C12H18N2O — CID 110855737
N-butyl-N,3-dimethylpyridine-4-carboxamide (PubChem CID 110855737) has the molecular formula C12H18N2O and a molecular weight of 206.29 g/mol. Its IUPAC name is N-butyl-N,3-dimethylpyridine-4-carboxamide.
| Compound Name | N-butyl-N,3-dimethylpyridine-4-carboxamide |
|---|---|
| PubChem CID | 110855737 |
| Molecular Formula | C12H18N2O |
| Molecular Weight | 206.29 g/mol |
| Exact Mass | 206.14 |
| IUPAC Name | N-butyl-N,3-dimethylpyridine-4-carboxamide |
| SMILES | CCCCN(C)C(=O)c1ccncc1C |
| InChI | InChI=1S/C12H18N2O/c1-4-5-8-14(3)12(15)11-6-7-13-9-10(11)2/h6-7,9H,4-5,8H2,1-3H3 |
| InChIKey | FSGPCDODGVQXDW-UHFFFAOYSA-N |
| XLogP | 2.26 |
| TPSA | 33.20 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.29 |
| LogP ≤ 5 | 2.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |