C15H23NO2 — CID 110761549
N-butyl-2-methoxy-N,4,5-trimethylbenzamide (PubChem CID 110761549) has the molecular formula C15H23NO2 and a molecular weight of 249.35 g/mol. Its IUPAC name is N-butyl-2-methoxy-N,4,5-trimethylbenzamide.
| Compound Name | N-butyl-2-methoxy-N,4,5-trimethylbenzamide |
|---|---|
| PubChem CID | 110761549 |
| Molecular Formula | C15H23NO2 |
| Molecular Weight | 249.35 g/mol |
| Exact Mass | 249.17 |
| IUPAC Name | N-butyl-2-methoxy-N,4,5-trimethylbenzamide |
| SMILES | CCCCN(C)C(=O)c1cc(C)c(C)cc1OC |
| InChI | InChI=1S/C15H23NO2/c1-6-7-8-16(4)15(17)13-9-11(2)12(3)10-14(13)18-5/h9-10H,6-8H2,1-5H3 |
| InChIKey | HIVIXRALCDISGT-UHFFFAOYSA-N |
| XLogP | 3.18 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.35 |
| LogP ≤ 5 | 3.18 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |