About 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane
1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane (PubChem CID 91068809) has the molecular formula C8H8Cl4OS
and a molecular weight of 294.03 g/mol. Its IUPAC name is 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane.
Molecular Properties
| Compound Name | 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane |
| PubChem CID | 91068809 |
| Molecular Formula | C8H8Cl4OS |
| Molecular Weight | 294.03 g/mol |
| Exact Mass | 291.90 |
| IUPAC Name | 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane |
| SMILES | CC(=O)c1sccc1C.ClC(Cl)(Cl)Cl |
| InChI | InChI=1S/C7H8OS.CCl4/c1-5-3-4-9-7(5)6(2)8;2-1(3,4)5/h3-4H,1-2H3; |
| InChIKey | BRUOUGUTOUAYJQ-UHFFFAOYSA-N |
| XLogP | 4.81 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 294.03 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane?
The IUPAC name of 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane (CID 91068809) is 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane.
What is the SMILES notation for 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane?
The canonical SMILES for 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane is CC(=O)c1sccc1C.ClC(Cl)(Cl)Cl.
What is the InChIKey of 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane?
The InChIKey is BRUOUGUTOUAYJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H8OS.CCl4/c1-5-3-4-9-7(5)6(2)8;2-1(3,4)5/h3-4H,1-2H3;.
What are the key properties of 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane?
1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane has a molecular weight of 294.03 g/mol, XLogP of 4.81, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(3-methylthiophen-2-yl)ethanone;tetrachloromethane is sourced from PubChem (CID 91068809), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).