About N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide
N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide (PubChem CID 108528439) has the molecular formula C17H18N2O4
and a molecular weight of 314.34 g/mol. Its IUPAC name is N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide.
Molecular Properties
| Compound Name | N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide |
| PubChem CID | 108528439 |
| Molecular Formula | C17H18N2O4 |
| Molecular Weight | 314.34 g/mol |
| Exact Mass | 314.13 |
| IUPAC Name | N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide |
| SMILES | CCOc1ccccc1NC(=O)C(=O)N(C)c1ccc(O)cc1 |
| InChI | InChI=1S/C17H18N2O4/c1-3-23-15-7-5-4-6-14(15)18-16(21)17(22)19(2)12-8-10-13(20)11-9-12/h4-11,20H,3H2,1-2H3,(H,18,21) |
| InChIKey | DGKQRZTZRAHYBT-UHFFFAOYSA-N |
| XLogP | 2.39 |
| TPSA | 78.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 314.34 |
| LogP ≤ 5 | 2.39 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'diketo_group', 'substructure': 'N/A'} |
|---|
Analyze N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide?
The IUPAC name of N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide (CID 108528439) is N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide.
What is the SMILES notation for N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide?
The canonical SMILES for N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide is CCOc1ccccc1NC(=O)C(=O)N(C)c1ccc(O)cc1.
What is the InChIKey of N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide?
The InChIKey is DGKQRZTZRAHYBT-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H18N2O4/c1-3-23-15-7-5-4-6-14(15)18-16(21)17(22)19(2)12-8-10-13(20)11-9-12/h4-11,20H,3H2,1-2H3,(H,18,21).
What are the key properties of N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide?
N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide has a molecular weight of 314.34 g/mol, XLogP of 2.39, 4 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-ethoxyphenyl)-N'-(4-hydroxyphenyl)-N'-methyloxamide is sourced from PubChem (CID 108528439), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).