C18H19NO6S — CID 22456238
2-[[4-(2-phenylbutanoyloxy)phenyl]sulfonylamino]acetic acid (PubChem CID 22456238) has the molecular formula C18H19NO6S and a molecular weight of 377.42 g/mol. Its IUPAC name is 2-[[4-(2-phenylbutanoyloxy)phenyl]sulfonylamino]acetic acid.
| Compound Name | 2-[[4-(2-phenylbutanoyloxy)phenyl]sulfonylamino]acetic acid |
|---|---|
| PubChem CID | 22456238 |
| Molecular Formula | C18H19NO6S |
| Molecular Weight | 377.42 g/mol |
| Exact Mass | 377.09 |
| IUPAC Name | 2-[[4-(2-phenylbutanoyloxy)phenyl]sulfonylamino]acetic acid |
| SMILES | CCC(C(=O)Oc1ccc(S(=O)(=O)NCC(=O)O)cc1)c1ccccc1 |
| InChI | InChI=1S/C18H19NO6S/c1-2-16(13-6-4-3-5-7-13)18(22)25-14-8-10-15(11-9-14)26(23,24)19-12-17(20)21/h3-11,16,19H,2,12H2,1H3,(H,20,21) |
| InChIKey | WPHLMHWSLYJFQU-UHFFFAOYSA-N |
| XLogP | 2.15 |
| TPSA | 109.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.42 |
| LogP ≤ 5 | 2.15 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|