C16H23F3N2O — CID 59726238
N-ethyl-N-[(1-methylpiperidin-4-yl)methyl]-4-(trifluoromethoxy)aniline (PubChem CID 59726238) has the molecular formula C16H23F3N2O and a molecular weight of 316.37 g/mol. Its IUPAC name is N-ethyl-N-[(1-methylpiperidin-4-yl)methyl]-4-(trifluoromethoxy)aniline.
| Compound Name | N-ethyl-N-[(1-methylpiperidin-4-yl)methyl]-4-(trifluoromethoxy)aniline |
|---|---|
| PubChem CID | 59726238 |
| Molecular Formula | C16H23F3N2O |
| Molecular Weight | 316.37 g/mol |
| Exact Mass | 316.18 |
| IUPAC Name | N-ethyl-N-[(1-methylpiperidin-4-yl)methyl]-4-(trifluoromethoxy)aniline |
| SMILES | CCN(CC1CCN(C)CC1)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C16H23F3N2O/c1-3-21(12-13-8-10-20(2)11-9-13)14-4-6-15(7-5-14)22-16(17,18)19/h4-7,13H,3,8-12H2,1-2H3 |
| InChIKey | VHRFHNBFEXTDQY-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.37 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|