C15H21F3N2O — CID 170208259
(3S,4R)-N,1,3-trimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine (PubChem CID 170208259) has the molecular formula C15H21F3N2O and a molecular weight of 302.34 g/mol. Its IUPAC name is (3S,4R)-N,1,3-trimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine.
| Compound Name | (3S,4R)-N,1,3-trimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine |
|---|---|
| PubChem CID | 170208259 |
| Molecular Formula | C15H21F3N2O |
| Molecular Weight | 302.34 g/mol |
| Exact Mass | 302.16 |
| IUPAC Name | (3S,4R)-N,1,3-trimethyl-N-[4-(trifluoromethoxy)phenyl]piperidin-4-amine |
| SMILES | C[C@H]1CN(C)CC[C@H]1N(C)c1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C15H21F3N2O/c1-11-10-19(2)9-8-14(11)20(3)12-4-6-13(7-5-12)21-15(16,17)18/h4-7,11,14H,8-10H2,1-3H3/t11-,14+/m0/s1 |
| InChIKey | DZXGASGAMDULPP-SMDDNHRTSA-N |
| XLogP | 3.36 |
| TPSA | 15.71 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 302.34 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|