C18H31F3N2O — CID 169122968
ethane;N-methyl-4-(trifluoromethoxy)aniline;1,2,5-trimethylpiperidine (PubChem CID 169122968) has the molecular formula C18H31F3N2O and a molecular weight of 348.45 g/mol. Its IUPAC name is ethane;N-methyl-4-(trifluoromethoxy)aniline;1,2,5-trimethylpiperidine.
| Compound Name | ethane;N-methyl-4-(trifluoromethoxy)aniline;1,2,5-trimethylpiperidine |
|---|---|
| PubChem CID | 169122968 |
| Molecular Formula | C18H31F3N2O |
| Molecular Weight | 348.45 g/mol |
| Exact Mass | 348.24 |
| IUPAC Name | ethane;N-methyl-4-(trifluoromethoxy)aniline;1,2,5-trimethylpiperidine |
| SMILES | CC.CC1CCC(C)N(C)C1.CNc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C8H8F3NO.C8H17N.C2H6/c1-12-6-2-4-7(5-3-6)13-8(9,10)11;1-7-4-5-8(2)9(3)6-7;1-2/h2-5,12H,1H3;7-8H,4-6H2,1-3H3;1-2H3 |
| InChIKey | ULCTWLMOAPHFTD-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.45 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|