C23H29F3N4O2S — CID 170209526
7-[(2S,5R)-2,5-dimethyl-4-[N-methyl-4-(trifluoromethoxy)anilino]piperidin-1-yl]-2,4-dimethyl-5H-[1,3]thiazolo[5,4-b]pyridin-5-ol (PubChem CID 170209526) has the molecular formula C23H29F3N4O2S and a molecular weight of 482.57 g/mol. Its IUPAC name is 7-[(2S,5R)-2,5-dimethyl-4-[N-methyl-4-(trifluoromethoxy)anilino]piperidin-1-yl]-2,4-dimethyl-5H-[1,3]thiazolo[5,4-b]pyridin-5-ol.
| Compound Name | 7-[(2S,5R)-2,5-dimethyl-4-[N-methyl-4-(trifluoromethoxy)anilino]piperidin-1-yl]-2,4-dimethyl-5H-[1,3]thiazolo[5,4-b]pyridin-5-ol |
|---|---|
| PubChem CID | 170209526 |
| Molecular Formula | C23H29F3N4O2S |
| Molecular Weight | 482.57 g/mol |
| Exact Mass | 482.20 |
| IUPAC Name | 7-[(2S,5R)-2,5-dimethyl-4-[N-methyl-4-(trifluoromethoxy)anilino]piperidin-1-yl]-2,4-dimethyl-5H-[1,3]thiazolo[5,4-b]pyridin-5-ol |
| SMILES | Cc1nc2c(s1)N(C)C(O)C=C2N1C[C@@H](C)C(N(C)c2ccc(OC(F)(F)F)cc2)C[C@@H]1C |
| InChI | InChI=1S/C23H29F3N4O2S/c1-13-12-30(19-11-20(31)29(5)22-21(19)27-15(3)33-22)14(2)10-18(13)28(4)16-6-8-17(9-7-16)32-23(24,25)26/h6-9,11,13-14,18,20,31H,10,12H2,1-5H3/t13-,14+,18?,20?/m1/s1 |
| InChIKey | UUGKIRCIKOYZOI-OJPXZBMZSA-N |
| XLogP | 4.69 |
| TPSA | 52.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 482.57 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|