C15H21F2N3O3 — CID 133429286
N-[3-(difluoromethoxy)-4-nitrophenyl]-N,1,3-trimethylpiperidin-4-amine (PubChem CID 133429286) has the molecular formula C15H21F2N3O3 and a molecular weight of 329.35 g/mol. Its IUPAC name is N-[3-(difluoromethoxy)-4-nitrophenyl]-N,1,3-trimethylpiperidin-4-amine.
| Compound Name | N-[3-(difluoromethoxy)-4-nitrophenyl]-N,1,3-trimethylpiperidin-4-amine |
|---|---|
| PubChem CID | 133429286 |
| Molecular Formula | C15H21F2N3O3 |
| Molecular Weight | 329.35 g/mol |
| Exact Mass | 329.16 |
| IUPAC Name | N-[3-(difluoromethoxy)-4-nitrophenyl]-N,1,3-trimethylpiperidin-4-amine |
| SMILES | CC1CN(C)CCC1N(C)c1ccc([N+](=O)[O-])c(OC(F)F)c1 |
| InChI | InChI=1S/C15H21F2N3O3/c1-10-9-18(2)7-6-12(10)19(3)11-4-5-13(20(21)22)14(8-11)23-15(16)17/h4-5,8,10,12,15H,6-7,9H2,1-3H3 |
| InChIKey | HHJDWUJCXFIJON-UHFFFAOYSA-N |
| XLogP | 2.97 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.35 |
| LogP ≤ 5 | 2.97 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|