C18H19F4N3O4S — CID 146336996
3-fluoro-4-[[2-(hydroxymethyl)cyclopentyl]sulfamoyl]-1-methyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide (PubChem CID 146336996) has the molecular formula C18H19F4N3O4S and a molecular weight of 449.43 g/mol. Its IUPAC name is 3-fluoro-4-[[2-(hydroxymethyl)cyclopentyl]sulfamoyl]-1-methyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide.
| Compound Name | 3-fluoro-4-[[2-(hydroxymethyl)cyclopentyl]sulfamoyl]-1-methyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide |
|---|---|
| PubChem CID | 146336996 |
| Molecular Formula | C18H19F4N3O4S |
| Molecular Weight | 449.43 g/mol |
| Exact Mass | 449.10 |
| IUPAC Name | 3-fluoro-4-[[2-(hydroxymethyl)cyclopentyl]sulfamoyl]-1-methyl-N-(3,4,5-trifluorophenyl)pyrrole-2-carboxamide |
| SMILES | Cn1cc(S(=O)(=O)NC2CCCC2CO)c(F)c1C(=O)Nc1cc(F)c(F)c(F)c1 |
| InChI | InChI=1S/C18H19F4N3O4S/c1-25-7-14(30(28,29)24-13-4-2-3-9(13)8-26)16(22)17(25)18(27)23-10-5-11(19)15(21)12(20)6-10/h5-7,9,13,24,26H,2-4,8H2,1H3,(H,23,27) |
| InChIKey | KBBPEOTWDGXUPR-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 100.43 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.43 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|