C20H21N3O4S — CID 31898842
N-(2,3-dihydro-1H-inden-5-yl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 31898842) has the molecular formula C20H21N3O4S and a molecular weight of 399.47 g/mol. Its IUPAC name is N-(2,3-dihydro-1H-inden-5-yl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(2,3-dihydro-1H-inden-5-yl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 31898842 |
| Molecular Formula | C20H21N3O4S |
| Molecular Weight | 399.47 g/mol |
| Exact Mass | 399.13 |
| IUPAC Name | N-(2,3-dihydro-1H-inden-5-yl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc4c(c3)CCC4)cc2)CCN1 |
| InChI | InChI=1S/C20H21N3O4S/c24-19-13-23(11-10-21-19)28(26,27)18-8-5-15(6-9-18)20(25)22-17-7-4-14-2-1-3-16(14)12-17/h4-9,12H,1-3,10-11,13H2,(H,21,24)(H,22,25) |
| InChIKey | LVESUTANQJNIGW-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 95.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.47 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |