C23H22N4O4S — CID 31983039
N-(4-anilinophenyl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide (PubChem CID 31983039) has the molecular formula C23H22N4O4S and a molecular weight of 450.52 g/mol. Its IUPAC name is N-(4-anilinophenyl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide.
| Compound Name | N-(4-anilinophenyl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide |
|---|---|
| PubChem CID | 31983039 |
| Molecular Formula | C23H22N4O4S |
| Molecular Weight | 450.52 g/mol |
| Exact Mass | 450.14 |
| IUPAC Name | N-(4-anilinophenyl)-4-(3-oxopiperazin-1-yl)sulfonylbenzamide |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccc(Nc4ccccc4)cc3)cc2)CCN1 |
| InChI | InChI=1S/C23H22N4O4S/c28-22-16-27(15-14-24-22)32(30,31)21-12-6-17(7-13-21)23(29)26-20-10-8-19(9-11-20)25-18-4-2-1-3-5-18/h1-13,25H,14-16H2,(H,24,28)(H,26,29) |
| InChIKey | LKUSISQNYSGCLR-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 107.61 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 450.52 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |