C20H19N5O4S — CID 55596683
4-(3-oxopiperazin-1-yl)sulfonyl-N-(1-phenylpyrazol-3-yl)benzamide (PubChem CID 55596683) has the molecular formula C20H19N5O4S and a molecular weight of 425.47 g/mol. Its IUPAC name is 4-(3-oxopiperazin-1-yl)sulfonyl-N-(1-phenylpyrazol-3-yl)benzamide.
| Compound Name | 4-(3-oxopiperazin-1-yl)sulfonyl-N-(1-phenylpyrazol-3-yl)benzamide |
|---|---|
| PubChem CID | 55596683 |
| Molecular Formula | C20H19N5O4S |
| Molecular Weight | 425.47 g/mol |
| Exact Mass | 425.12 |
| IUPAC Name | 4-(3-oxopiperazin-1-yl)sulfonyl-N-(1-phenylpyrazol-3-yl)benzamide |
| SMILES | O=C1CN(S(=O)(=O)c2ccc(C(=O)Nc3ccn(-c4ccccc4)n3)cc2)CCN1 |
| InChI | InChI=1S/C20H19N5O4S/c26-19-14-24(13-11-21-19)30(28,29)17-8-6-15(7-9-17)20(27)22-18-10-12-25(23-18)16-4-2-1-3-5-16/h1-10,12H,11,13-14H2,(H,21,26)(H,22,23,27) |
| InChIKey | RGRKZBAIMYVLTM-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 113.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.47 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |